CAS 75228-74-9
:2-chloro-N-methyl-N-[(5-methylfuran-2-yl)methyl]acetamide
Description:
2-Chloro-N-methyl-N-[(5-methylfuran-2-yl)methyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro group, a methyl group, and a furan moiety. This compound features a chloro substituent on the acetamide backbone, which can influence its reactivity and solubility. The presence of the furan ring, a five-membered aromatic heterocycle, contributes to its potential biological activity and interaction with various biological targets. The methyl groups enhance the lipophilicity of the molecule, potentially affecting its pharmacokinetics. As with many organic compounds, its properties such as melting point, boiling point, and solubility in various solvents can vary based on environmental conditions and purity. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could impart specific biological activities. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C9H12ClNO2
InChI:InChI=1/C9H12ClNO2/c1-7-3-4-8(13-7)6-11(2)9(12)5-10/h3-4H,5-6H2,1-2H3
SMILES:Cc1ccc(CN(C)C(=O)CCl)o1
Synonyms:- 2-chloro-N-methyl-N-[(5-methyl-2-furyl)methyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.