CAS 75230-50-1

4-Methylbenzenesulfonic acid 2-[1-(4-chlorophenyl)ethylidene]hydrazide

Description:

4-Methylbenzenesulfonic acid 2-[1-(4-chlorophenyl)ethylidene]hydrazide, with the CAS number 75230-50-1, is a chemical compound that features a sulfonic acid group and a hydrazide functional group. This compound typically exhibits characteristics associated with both hydrazides and sulfonic acids, including potential solubility in polar solvents due to the presence of the sulfonic acid moiety. The presence of the 4-chlorophenyl group may impart specific electronic and steric properties, influencing its reactivity and interaction with other molecules. Such compounds often display biological activity, making them of interest in pharmaceutical and agrochemical research. Additionally, the hydrazide functional group can participate in various chemical reactions, including condensation and redox reactions. The compound's stability, reactivity, and potential applications can vary based on its molecular structure and the functional groups present. Overall, this compound represents a unique combination of functional groups that may contribute to its utility in various chemical and biological contexts.

Formula: C₁₅H₁₅ClN₂O₂S

InChI: InChI=1S/C15H15ClN2O2S/c1-11-3-9-15(10-4-11)21(19,20)18-17-12(2)13-5-7-14(16)8-6-13/h3-10,18H,1-2H3

InChI key: InChIKey=LXTKFUSDWSCUJN-UHFFFAOYSA-N

SMILES: S(NN=C(C)C1=CC=C(Cl)C=C1)(=O)(=O)C2=CC=C(C)C=C2

Synonyms:

• p-Chloroacetophenone tosylhydrazone
• 4-Methylbenzenesulfonic acid 2-[1-(4-chlorophenyl)ethylidene]hydrazide
• Benzenesulfonic acid, 4-methyl-, [1-(4-chlorophenyl)ethylidene]hydrazide
• Benzenesulfonic acid, 4-methyl-, 2-[1-(4-chlorophenyl)ethylidene]hydrazide

N'-[(1E)-1-(4-chlorophenyl)ethylidene]-4-methylbenzene-1-sulfonohydrazide

CAS: 75230-50-1

Formula: C₁₅H₁₅ClN₂O₂S

Purity: 97%

Molecular weight: 322.8098

Ref: IN-DA01DHAA