CymitQuimica logo

CAS 75232-10-9

:

N′-[6-(4-Chlorophenyl)-3,4,5-tricyano-2-pyridinyl]-N,N-dimethylmethanimidamide

Description:
N′-[6-(4-Chlorophenyl)-3,4,5-tricyano-2-pyridinyl]-N,N-dimethylmethanimidamide, with the CAS number 75232-10-9, is a synthetic organic compound characterized by its complex structure, which includes a pyridine ring substituted with multiple cyano groups and a chlorophenyl moiety. This compound exhibits significant electron-withdrawing properties due to the presence of cyano groups, which can influence its reactivity and stability. The dimethylmethanimidamide functional group contributes to its potential as a ligand in coordination chemistry or as an intermediate in organic synthesis. Its unique structure may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the presence of chlorine in the chlorophenyl group can enhance lipophilicity, potentially affecting its solubility and bioavailability. Overall, this compound's characteristics suggest it may have applications in various fields, including medicinal chemistry and materials science, although specific applications would depend on further research and characterization.
Formula:C17H11ClN6
InChI:InChI=1S/C17H11ClN6/c1-24(2)10-22-17-15(9-21)13(7-19)14(8-20)16(23-17)11-3-5-12(18)6-4-11/h3-6,10H,1-2H3
InChI key:InChIKey=JNWYISOZCLFFRU-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N=C(N=CN(C)C)C(C#N)=C1C#N)C2=CC=C(Cl)C=C2
Synonyms:
  • N′-[6-(4-Chlorophenyl)-3,4,5-tricyano-2-pyridinyl]-N,N-dimethylmethanimidamide
  • Methanimidamide, N′-[6-(4-chlorophenyl)-3,4,5-tricyano-2-pyridinyl]-N,N-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.