CymitQuimica logo

CAS 75232-51-8

:

Boroxin, tris(octadecyloxy)-

Description:
Boroxin, tris(octadecyloxy)-, with the CAS number 75232-51-8, is a chemical compound characterized by its unique structure that includes a boron atom bonded to three octadecyloxy groups. This compound is typically used in various applications due to its surfactant properties, which can enhance solubility and stability in formulations. The long octadecyloxy chains contribute to its hydrophobic characteristics, making it suitable for use in emulsions and as a dispersing agent in different chemical systems. Additionally, the presence of boron in its structure may impart specific reactivity or catalytic properties, which can be advantageous in certain chemical processes. The compound is generally stable under standard conditions but may require careful handling due to its potential interactions with other substances. Overall, Boroxin, tris(octadecyloxy)- is notable for its surfactant capabilities and potential applications in materials science and chemical engineering.
Formula:C54H111B3O6
InChI:InChI=1S/C54H111B3O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-58-55-61-56(59-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)63-57(62-55)60-54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h4-54H2,1-3H3
InChI key:InChIKey=GIPUZZCLWJNXQV-UHFFFAOYSA-N
SMILES:O(CCCCCCCCCCCCCCCCCC)B1OB(OCCCCCCCCCCCCCCCCCC)OB(OCCCCCCCCCCCCCCCCCC)O1
Synonyms:
  • Boroxin, tris(octadecyloxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.