CAS 75237-09-1
:ethyl 4-(4-tert-butylphenyl)-4-oxobutanoate
Description:
Ethyl 4-(4-tert-butylphenyl)-4-oxobutanoate, identified by its CAS number 75237-09-1, is an organic compound characterized by its ester functional group and a ketone moiety. This compound features a tert-butyl group, which contributes to its hydrophobic nature and influences its solubility in organic solvents. The presence of the ethyl ester group suggests that it may exhibit moderate volatility and reactivity, making it suitable for various chemical applications, including synthesis and as an intermediate in organic reactions. The structure includes a phenyl ring, which can enhance its stability and affect its electronic properties. Ethyl 4-(4-tert-butylphenyl)-4-oxobutanoate may also exhibit interesting biological activities, although specific biological data would require further investigation. Its physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups. Overall, this compound is of interest in both synthetic organic chemistry and potential applications in pharmaceuticals or materials science.
Formula:C16H22O3
InChI:InChI=1/C16H22O3/c1-5-19-15(18)11-10-14(17)12-6-8-13(9-7-12)16(2,3)4/h6-9H,5,10-11H2,1-4H3
SMILES:CCOC(=O)CCC(=O)c1ccc(cc1)C(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.