CAS 75267-17-3

ethyl 5-formyl-1,3-benzodioxole-4-carboxylate

Description:

Ethyl 5-formyl-1,3-benzodioxole-4-carboxylate, identified by its CAS number 75267-17-3, is an organic compound characterized by its complex structure, which includes a benzodioxole moiety. This compound features both an aldehyde group (formyl) and an ester group (ethyl carboxylate), contributing to its reactivity and potential applications in organic synthesis. The presence of the benzodioxole structure often imparts interesting electronic properties and can influence the compound's solubility and stability. Ethyl 5-formyl-1,3-benzodioxole-4-carboxylate may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis typically involves multi-step organic reactions, and it can serve as a versatile intermediate in the preparation of various derivatives. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, this compound represents a valuable entity in the field of organic chemistry, with potential applications in pharmaceuticals and materials science.

Formula: C₁₁H₁₀O₅

InChI: InChI=1/C11H10O5/c1-2-14-11(13)9-7(5-12)3-4-8-10(9)16-6-15-8/h3-5H,2,6H2,1H3

SMILES: CCOC(=O)c1c(ccc2c1OCO2)C=O

Synonyms:

• 1,3-Benzodioxole-4-Carboxylic Acid, 5-Formyl-, Ethyl Ester
• Ethyl-5-formyl-1,3-benzodioxol-4-carboxylat
• Ethyl 5-formyl-1,3-benzodioxole-4-carboxylate
• 5-formyl-benzo[1,3]dioxole-4-carboxylic acid ethyl ester