
CAS 75268-90-5
:Poly(2-cyanoacrylic acid)
Description:
Poly(2-cyanoacrylic acid) is a synthetic polymer characterized by its unique chemical structure derived from the polymerization of 2-cyanoacrylic acid monomers. This polymer exhibits a high degree of biocompatibility and is soluble in various organic solvents, making it suitable for a range of applications, particularly in biomedical fields. Its properties include good adhesion, flexibility, and the ability to form films, which are advantageous for coatings and drug delivery systems. The presence of cyano groups in its structure contributes to its chemical reactivity, allowing for further functionalization and modification. Additionally, poly(2-cyanoacrylic acid) can undergo hydrolysis, leading to the formation of carboxylic acid groups, which can enhance its interaction with biological tissues. Its thermal stability and mechanical properties can vary depending on the molecular weight and degree of cross-linking. Overall, poly(2-cyanoacrylic acid) is a versatile polymer with significant potential in various industrial and medical applications, particularly in tissue engineering and controlled drug release systems.
Formula:(C4H3NO2)x
InChI:InChI=1S/C4H3NO2/c1-3(2-5)4(6)7/h1H2,(H,6,7)
InChI key:InChIKey=IJVRPNIWWODHHA-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C#N)=C
Synonyms:- Poly(2-cyanoacrylic acid)
- 2-Propenoic acid, 2-cyano-, homopolymer
- Poly(α-cyanoacrylic acid)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
