CymitQuimica logo

CAS 75274-22-5

:

ethyl oxo(pyrimidin-4-ylamino)acetate

Description:
Ethyl oxo(pyrimidin-4-ylamino)acetate, with the CAS number 75274-22-5, is a chemical compound characterized by its unique structure that includes an ethyl ester group, a pyrimidine ring, and an aminoacetate moiety. This compound typically exhibits properties associated with both its ester and amine functionalities, such as solubility in polar organic solvents and potential reactivity in various chemical reactions. The presence of the pyrimidine ring suggests that it may participate in hydrogen bonding and exhibit biological activity, potentially serving as a pharmacophore in medicinal chemistry. Additionally, the oxo group contributes to its reactivity, allowing for further derivatization or interaction with other chemical species. Ethyl oxo(pyrimidin-4-ylamino)acetate may be of interest in research areas such as drug development, agrochemicals, or materials science, where its specific properties can be leveraged for various applications. As with any chemical substance, safety data and handling precautions should be observed when working with this compound.
Formula:C8H9N3O3
InChI:InChI=1/C8H9N3O3/c1-2-14-8(13)7(12)11-6-3-4-9-5-10-6/h3-5H,2H2,1H3,(H,9,10,11,12)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.