CAS 75279-58-2

2,4,5-Trimethylbenzeneacetonitrile

Description:

2,4,5-Trimethylbenzeneacetonitrile, with the CAS number 75279-58-2, is an organic compound characterized by its structure, which includes a benzene ring substituted with three methyl groups at the 2, 4, and 5 positions, along with an acetonitrile functional group. This compound is typically a colorless to pale yellow liquid and is known for its aromatic properties due to the presence of the benzene ring. It is relatively non-polar, which influences its solubility in organic solvents while being less soluble in water. The presence of the acetonitrile group imparts certain reactivity, making it useful in various chemical syntheses and applications. Additionally, 2,4,5-trimethylbenzeneacetonitrile may exhibit moderate toxicity, necessitating appropriate safety measures during handling. Its unique structure and properties make it of interest in organic chemistry and industrial applications, particularly in the synthesis of other chemical compounds.

Formula: C₁₁H₁₃N

InChI: InChI=1S/C11H13N/c1-8-6-10(3)11(4-5-12)7-9(8)2/h6-7H,4H2,1-3H3

InChI key: InChIKey=MSZOPWWSWGLPST-UHFFFAOYSA-N

SMILES: C(C#N)C1=C(C)C=C(C)C(C)=C1

Synonyms:

• 2-(2,4,5-Trimethylphenyl)acetonitrile
• (2,4,5-Trimethyl-phenyl)-acetonitrile
• 2,4,5-Trimethylbenzeneacetonitrile
• Benzeneacetonitrile, 2,4,5-trimethyl-

2-(2,4,5-Trimethylphenyl)acetonitrile

CAS: 75279-58-2

Formula: C₁₁H₁₃N

Color and Shape: Liquid

Molecular weight: 159.2276

Ref: IN-DA008QL9

2,4,5-Trimethylphenylacetonitrile

CAS: 75279-58-2

2,4,5-Trimethylphenylacetonitrile

Molecular weight: 159.22762g/mol

Ref: 54-OR1021145

2-(3,4,5-Trimethylphenyl)acetonitrile

CAS: 75279-58-2

2-(3,4,5-Trimethylphenyl)acetonitrile (2TMPAN) is a versatile building block that can be used in the synthesis of complex compounds and research chemicals. This chemical is a reagent that can be used to synthesize high-quality and useful intermediates. 2TMPAN has been shown to have a number of applications as a reaction component or scaffold for the synthesis of pharmaceuticals and other organic molecules.

Formula: C₁₁H₁₃N

Purity: Min. 95%

Molecular weight: 159.23 g/mol

Ref: 3D-FT70126