CAS 75283-35-1
:(4E)-hepta-4,6-dienoic acid
Description:
(4E)-hepta-4,6-dienoic acid, also known as sorbic acid, is an unsaturated fatty acid characterized by its two double bonds located at the 4th and 6th carbon positions of the heptanoic acid chain. This compound typically appears as a colorless to pale yellow liquid and has a distinctive odor. It is soluble in organic solvents and exhibits limited solubility in water. The presence of double bonds contributes to its reactivity, making it susceptible to oxidation and polymerization under certain conditions. (4E)-hepta-4,6-dienoic acid is primarily used in the food industry as a preservative due to its antimicrobial properties, inhibiting the growth of molds, yeasts, and some bacteria. Additionally, it finds applications in the production of various chemical intermediates and as a flavoring agent. Its safety profile indicates that it is generally recognized as safe (GRAS) when used in food products, although it may cause allergic reactions in sensitive individuals. Overall, this compound plays a significant role in both food preservation and chemical synthesis.
Formula:C7H10O2
InChI:InChI=1/C7H10O2/c1-2-3-4-5-6-7(8)9/h2-4H,1,5-6H2,(H,8,9)/b4-3+
Synonyms:- Hepta-4,6-dienoic acid
- 4,6-Heptadienoic acid, (4E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.