CAS 7529-33-1
:6-butoxy-6-oxohexanoic acid
Description:
6-Butoxy-6-oxohexanoic acid, with the CAS number 7529-33-1, is an organic compound characterized by its carboxylic acid functional group and a butoxy substituent. This compound features a six-carbon chain with a ketone group at the sixth position and a butoxy group at the same carbon, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of both the carboxylic acid and the ketone functional groups suggests that it may exhibit acidic behavior and participate in various chemical reactions, such as esterification or condensation. Its solubility in organic solvents and limited solubility in water are typical for compounds with long hydrocarbon chains. Additionally, it may have applications in organic synthesis, as an intermediate in the production of other chemical compounds, or in the formulation of specialty chemicals. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H18O4
InChI:InChI=1/C10H18O4/c1-2-3-8-14-10(13)7-5-4-6-9(11)12/h2-8H2,1H3,(H,11,12)
Synonyms:- hexanedioic acid, monobutyl ester
- 6-Butoxy-6-oxohexanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
