CymitQuimica logo

CAS 75290-51-6

:

2-Fluoro-5-hydroxy-L-tyrosine

Description:
2-Fluoro-5-hydroxy-L-tyrosine is an amino acid derivative characterized by the presence of a fluorine atom and a hydroxyl group on the aromatic ring of the tyrosine structure. This compound is notable for its potential applications in biochemical research and pharmaceuticals, particularly in studies related to neurotransmitter synthesis and metabolic pathways. The fluorine substitution can influence the compound's reactivity and biological activity, potentially enhancing its stability or altering its interaction with enzymes and receptors. As a hydroxylated amino acid, it may participate in hydrogen bonding and contribute to the solubility and polarity of the molecule. The presence of both functional groups allows for diverse chemical reactivity, making it a valuable compound in synthetic organic chemistry. Additionally, its unique structure may provide insights into the role of modified amino acids in biological systems, particularly in the context of protein function and enzyme catalysis. Overall, 2-Fluoro-5-hydroxy-L-tyrosine represents an interesting subject for further research in medicinal chemistry and biochemistry.
Formula:C9H10FNO4
InChI:InChI=1S/C9H10FNO4/c10-5-3-8(13)7(12)2-4(5)1-6(11)9(14)15/h2-3,6,12-13H,1,11H2,(H,14,15)/t6-/m0/s1
InChI key:InChIKey=PAXWQORCRCBOCU-LURJTMIESA-N
SMILES:C([C@@H](C(O)=O)N)C1=C(F)C=C(O)C(O)=C1
Synonyms:
  • 2-Fluoro-5-hydroxy-L-tyrosine
  • (2S)-2-Amino-3-(2-fluoro-4,5-dihydroxyphenyl)propanoic acid
  • L-Tyrosine, 2-fluoro-5-hydroxy-
  • 6-FluoroDOPA
  • 6-Fluoro-L-dopa
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.