CAS 752969-48-5
:1-(1,3-Benzodioxol-5-ylmethyl)-5-(chloromethyl)-1H-imidazole
Description:
1-(1,3-Benzodioxol-5-ylmethyl)-5-(chloromethyl)-1H-imidazole, with the CAS number 752969-48-5, is a chemical compound characterized by its unique structural features, which include a benzodioxole moiety and an imidazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the chloromethyl group. The benzodioxole portion contributes to its potential biological activity, often associated with compounds that have applications in pharmaceuticals or agrochemicals. The imidazole ring is known for its role in various biochemical processes and can participate in coordination chemistry. The chloromethyl group may serve as a reactive site for further chemical modifications, enhancing the compound's versatility in synthetic applications. Overall, this compound's characteristics suggest it may have interesting pharmacological properties, although specific biological activities would require further investigation through empirical studies.
Formula:C12H11ClN2O2
InChI:InChI=1S/C12H11ClN2O2/c13-4-10-5-14-7-15(10)6-9-1-2-11-12(3-9)17-8-16-11/h1-3,5,7H,4,6,8H2
InChI key:InChIKey=ZOWFILOGULVYBW-UHFFFAOYSA-N
SMILES:C(C=1C=C2C(=CC1)OCO2)N3C(CCl)=CN=C3
Synonyms:- 1H-Imidazole, 1-(1,3-benzodioxol-5-ylmethyl)-5-(chloromethyl)-
- 1-(1,3-Benzodioxol-5-ylmethyl)-5-(chloromethyl)-1H-imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.