CymitQuimica logo

CAS 752981-45-6

:

7-chloropyrrolo[1,2-c]pyrimidine-3-carboxylic acid

Description:
7-Chloropyrrolo[1,2-c]pyrimidine-3-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. The presence of a chlorine atom at the 7-position of the pyrrolo ring contributes to its reactivity and potential biological activity. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification and amidation. This compound is of interest in medicinal chemistry due to its potential as a scaffold for drug development, particularly in targeting specific biological pathways. Its structural features may influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME). Additionally, the compound's unique arrangement of atoms may confer specific interactions with biological targets, making it a candidate for further research in therapeutic applications. Overall, 7-chloropyrrolo[1,2-c]pyrimidine-3-carboxylic acid exemplifies the complexity and diversity of heterocyclic compounds in chemical and pharmaceutical research.
Formula:C8H5ClN2O2
InChI:InChI=1/C8H5ClN2O2/c9-7-2-1-5-3-6(8(12)13)10-4-11(5)7/h1-4H,(H,12,13)
SMILES:c1cc(Cl)n2cnc(cc12)C(=O)O
Synonyms:
  • Pyrrolo[1,2-C]Pyrimidine-3-Carboxylic Acid, 7-Chloro-
  • 7-Chloropyrrolo[1,2-c]pyrimidine-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.