CAS 75302-66-8
:P,P-Di-4-morpholinylphosphinous chloride
Description:
P,P-Di-4-morpholinylphosphinous chloride is a chemical compound characterized by its phosphorus-containing structure, specifically featuring a phosphinous chloride functional group. This compound typically exhibits properties associated with organophosphorus compounds, including potential reactivity due to the presence of the chloride group, which can participate in nucleophilic substitution reactions. The morpholine rings contribute to the compound's solubility in polar solvents and may influence its biological activity, as morpholine derivatives are often explored for their pharmacological properties. The presence of the phosphinous group suggests potential applications in organic synthesis, particularly in the development of phosphine ligands for catalysis or as intermediates in the synthesis of more complex molecules. Safety considerations are important, as organophosphorus compounds can exhibit toxicity, and appropriate handling procedures should be followed. Overall, P,P-Di-4-morpholinylphosphinous chloride represents a versatile compound within the realm of organophosphorus chemistry, with implications in both industrial and research settings.
Formula:C8H16ClN2O2P
InChI:InChI=1S/C8H16ClN2O2P/c9-14(10-1-5-12-6-2-10)11-3-7-13-8-4-11/h1-8H2
InChI key:InChIKey=LMQYERHSWTWFIH-UHFFFAOYSA-N
SMILES:P(Cl)(N1CCOCC1)N2CCOCC2
Synonyms:- P,P-Di-4-morpholinylphosphinous chloride
- Phosphinous chloride, P,P-di-4-morpholinyl-
- Phosphinous chloride, di-4-morpholinyl-
- Dimorpholin-4-ylphosphinous chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
