CAS 75302-98-6
:2-(1,1-Dimethylethoxy)-2-oxoethyl 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetate
Description:
2-(1,1-Dimethylethoxy)-2-oxoethyl 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetate, with the CAS number 75302-98-6, is a synthetic organic compound that belongs to the class of indole derivatives. This compound features a complex structure characterized by an indole core, which is a bicyclic structure containing a benzene ring fused to a pyrrole ring. The presence of various functional groups, including an acetate moiety and a chlorobenzoyl group, contributes to its chemical reactivity and potential biological activity. The dimethylethoxy group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Such compounds are often investigated for their pharmacological properties, including anti-inflammatory, anticancer, or antimicrobial activities. The specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods and can vary based on the conditions under which they are measured. Overall, this compound represents a class of molecules with potential applications in medicinal chemistry and drug development.
Formula:C25H26ClNO6
InChI:InChI=1S/C25H26ClNO6/c1-15-19(13-22(28)32-14-23(29)33-25(2,3)4)20-12-18(31-5)10-11-21(20)27(15)24(30)16-6-8-17(26)9-7-16/h6-12H,13-14H2,1-5H3
InChI key:InChIKey=FPYWWHOBBPHPFR-UHFFFAOYSA-N
SMILES:C(=O)(N1C=2C(C(CC(OCC(OC(C)(C)C)=O)=O)=C1C)=CC(OC)=CC2)C3=CC=C(Cl)C=C3
Synonyms:- (tert-Butoxycarbonyl)methyl 2-[1-[(4-chlorophenyl)carbonyl]-5-methoxy-2-methylindol-3-yl]acetate
- (tert-Butoxycarbonyl)methyl2-[1-[(4-chlorophenyl)carbonyl]-5-methoxy-2-methylindol-3-yl]acetate
- 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-, 2-(1,1-dimethylethoxy)-2-oxoethyl ester
- 2-(1,1-Dimethylethoxy)-2-oxoethyl 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetate
- Acemetacin 1,1-dimethylethyl ester
- Acemetacin tert-butyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Acemetacin EP Impurity E
CAS:Formula:C25H26ClNO6Color and Shape:Pale Yellow SolidMolecular weight:471.93

