CAS 75308-46-2
:2,6-Dichloroisonicotinic Acid t-butyl ester
Description:
2,6-Dichloroisonicotinic Acid t-butyl ester is an organic compound characterized by its ester functional group, derived from isonicotinic acid. It features two chlorine atoms positioned at the 2 and 6 positions of the pyridine ring, which contributes to its unique chemical properties. The t-butyl ester group enhances its lipophilicity, making it more soluble in organic solvents compared to its acid counterpart. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its structure suggests potential biological activity, which can be explored in various research contexts. Additionally, the presence of chlorine atoms can influence its reactivity and stability, making it a subject of interest in studies related to halogenated compounds. Safety data should be consulted for handling, as halogenated compounds can exhibit toxicity or environmental persistence. Overall, 2,6-Dichloroisonicotinic Acid t-butyl ester is a versatile compound with applications in synthetic chemistry and potential biological relevance.
Formula:C10H11Cl2NO2
InChI:InChI=1/C10H11Cl2NO2/c1-10(2,3)15-9(14)6-4-7(11)13-8(12)5-6/h4-5H,1-3H3
SMILES:CC(C)(C)OC(=O)c1cc(Cl)nc(c1)Cl
Synonyms:- 4-Pyridinecarboxylic acid, 2,6-dichloro-, 1,1-dimethylethyl ester
- tert-Butyl 2,6-dichloroisonicotinate
- Tert-Butyl 2,6-Dichloropyridine-4-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
tert-Butyl 2,6-Dichloroisonicotinate
CAS:Formula:C10H11Cl2NO2Purity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:248.10tert-Butyl 2,6-dichloroisonicotinate
CAS:Formula:C10H11Cl2NO2Purity:97%Color and Shape:SolidMolecular weight:248.1058tert-Butyl 2,6-dichloroisonicotinate
CAS:tert-Butyl 2,6-dichloroisonicotinateFormula:C10H11Cl2NO2Purity:97%Molecular weight:248.10583tert-Butyl 2,6-dichloroisonicotinate
CAS:tert-Butyl 2,6-dichloroisonicotinateFormula:C10H11Cl2NO2Purity:97%Molecular weight:248.11tert-Butyl 2,6-dichloroisonicotinate
CAS:Formula:C10H11Cl2NO2Purity:97%Color and Shape:CrystallineMolecular weight:248.1Ref: 10-F036337
Discontinued product




