CAS 75319-63-0
:hexadecyl beta-D-glucopyranoside
Description:
Hexadecyl beta-D-glucopyranoside, with the CAS number 75319-63-0, is a glycoside that consists of a hexadecyl (C16) alkyl chain linked to a beta-D-glucopyranoside moiety. This compound is characterized by its amphiphilic nature, which arises from the hydrophobic long-chain fatty acid and the hydrophilic sugar component. As a surfactant, it exhibits properties such as lowering surface tension and forming micelles in aqueous solutions, making it useful in various applications, including as a detergent, emulsifier, and stabilizer in pharmaceutical formulations and cosmetic products. Hexadecyl beta-D-glucopyranoside is also known for its ability to enhance the solubility of hydrophobic compounds and can facilitate drug delivery systems. Additionally, it may exhibit biological activity, including potential antimicrobial properties. Its stability and solubility characteristics can vary depending on the pH and ionic strength of the solution, which is important for its practical applications in different environments.
Formula:C22H44O6
InChI:InChI=1/C22H44O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-27-22-21(26)20(25)19(24)18(17-23)28-22/h18-26H,2-17H2,1H3/t18-,19-,20+,21-,22-/m1/s1
Synonyms:- beta-D-Glucopyranoside, hexadecyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Hexadecyl β-D-glucopyranoside
CAS:Hexadecyl b-D-glucopyranoside is a divalent hydrocarbon that has been used as a hybridization probe to detect human papilloma virus (HPV) in tissue samples. It is also used as an analytical standard for the quantification of fatty acids, with a detection sensitivity of 10 ppm. The hexadecyl b-D-glucopyranoside can be synthesized from fatty acid esters and hydroxy groups. The product can be conditioned by buffers, such as calcium carbonate, before reacting with isopropyl palmitate to produce the desired reaction products. Hexadecyl b-D-glucopyranoside can be used as an additive in cosmetic products due to its conditioning properties.Formula:C22H44O6Purity:Min. 95%Color and Shape:PowderMolecular weight:404.58 g/mol


