CAS 75328-29-9

4-(2-morpholinoethoxy)benzene-1,2-diamine trihydrochloride

Description:

4-(2-Morpholinoethoxy)benzene-1,2-diamine trihydrochloride is a chemical compound characterized by its specific molecular structure, which includes a benzene ring substituted with both a morpholinoethoxy group and two amino groups. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of multiple hydrochloride groups, which enhance its solubility and ionic character. The morpholino group contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. The trihydrochloride form indicates that the compound can exist as a salt, which may influence its stability and bioavailability. Its properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other substances. As with many amines, it may exhibit basicity and can participate in various chemical reactions, including acylation and alkylation, making it versatile for synthetic applications. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₁₂H₂₂Cl₃N₃O₂

InChI: InChI=1/C12H19N3O2.3ClH/c13-11-2-1-10(9-12(11)14)17-8-5-15-3-6-16-7-4-15;;;/h1-2,9H,3-8,13-14H2;3*1H

SMILES: c1cc(c(cc1OCCN1CCOCC1)N)N.Cl.Cl.Cl

4-(2-Morpholinoethoxy)benzene-1,2-diamine trihydrochloride

CAS: 75328-29-9

4-(2-Morpholinoethoxy)benzene-1,2-diamine trihydrochloride

Purity: ≥95%

Molecular weight: 346.68g/mol

Ref: 54-OR300164