CAS 75332-44-4
:ethyl 3,4-diethoxybenzoate
Description:
Ethyl 3,4-diethoxybenzoate is an organic compound characterized by its ester functional group, derived from benzoic acid and ethanol. It features a benzene ring substituted with two ethoxy groups at the 3 and 4 positions, which significantly influence its chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid with a pleasant odor, making it useful in various applications, including as a flavoring agent or fragrance. Ethyl 3,4-diethoxybenzoate is soluble in organic solvents but has limited solubility in water due to its hydrophobic ethoxy groups. Its molecular structure contributes to its stability and relatively low reactivity under standard conditions, although it may undergo hydrolysis in the presence of strong acids or bases. Additionally, this compound can be utilized in synthetic organic chemistry as an intermediate in the preparation of other chemical entities. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C13H18O4
InChI:InChI=1/C13H18O4/c1-4-15-11-8-7-10(13(14)17-6-3)9-12(11)16-5-2/h7-9H,4-6H2,1-3H3
SMILES:CCOc1ccc(cc1OCC)C(=O)OCC
Synonyms:- Benzoic Acid, 3,4-Diethoxy-, Ethyl Ester
- Ethyl 3,4-diethoxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 3,4-diethoxybenzoate
CAS:Formula:C13H18O4Purity:97%Color and Shape:SolidMolecular weight:238.2796Ref: IN-DA003Q6G
100gTo inquire100mg25.00€250mg37.00€500mg54.00€1g61.00€5g134.00€10g169.00€25g329.00€Ethyl 3,4-diethoxybenzoate
CAS:Ethyl 3,4-diethoxybenzoate is an analgesic that belongs to the class of narcotic analgesics. It is a narcotic that binds to opioid receptors in the brain and spinal cord. This drug has been shown to be effective against bacterial strains resistant to codeine, such as Rhodococcus equi, and dihydrocodeine. It also has high biodegradability due to its ability to be metabolized by bacteria into harmless compounds. The immobilization efficiency of this drug is also high because it does not accumulate in tissues and can cross the blood-brain barrier.Formula:C13H18O4Purity:Min. 95%Color and Shape:PowderMolecular weight:238.28 g/mol




