CAS 7534-35-2
:1-thio-D-glucose
Description:
1-Thio-D-glucose is a sulfur-containing analog of glucose, where a sulfur atom replaces the oxygen atom in the hydroxyl group at the first carbon position. This modification imparts unique chemical properties to the molecule compared to its parent compound, D-glucose. The presence of sulfur can influence the reactivity and biological interactions of the compound, potentially affecting its role in biochemical pathways. 1-Thio-D-glucose is typically a white crystalline solid and is soluble in water, similar to glucose. It can participate in various chemical reactions, including those typical of carbohydrates, such as oxidation and reduction. The compound may also exhibit different biological activities, making it of interest in research related to carbohydrate metabolism and potential therapeutic applications. As with many thio derivatives, it may have implications in medicinal chemistry, particularly in the development of drugs targeting metabolic pathways. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C6H12O5S
InChI:InChI=1/C6H12O5S/c7-1-3(8)5(10)6(11)4(9)2-12/h2-11H,1H2/t3-,4+,5-,6-/m1/s1
Synonyms:- 1-Thio-.beta.-D-glucose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Thio-Beta-D-glucose-13C6 Sodium Salt Dihydrate (~90%)
CAS:Controlled ProductApplications 1-Thio-β-D-glucose-13C6 Sodium Salt is an intermediate in synthesizing Aurothioglucose-13C6 (A794792), a labelled analogue of Aurothioglucose (A794790), which is used in the treatment of rheumatoid arthritis and psoriasis.
References Solomon, D. et al.: J. Am. Med. Assoc., 305, 2525 (2011); Madeira, J. et al.: Inflammopharm., 297, 20 (2012)Formula:C6H11NaO5S•2(H2O)Purity:~90%Color and Shape:NeatMolecular weight:224.1621802
