CAS 7534-64-7
:(2,6-Dichlorophenyl)methyl thiocyanate
Description:
(2,6-Dichlorophenyl)methyl thiocyanate, with the CAS number 7534-64-7, is an organic compound characterized by the presence of a thiocyanate functional group attached to a dichlorophenylmethyl moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its moderate to high toxicity, necessitating careful handling and storage. The presence of chlorine atoms in the phenyl ring contributes to its reactivity and potential applications in various chemical syntheses, particularly in the field of agrochemicals and pharmaceuticals. Its thiocyanate group can participate in nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. Additionally, (2,6-Dichlorophenyl)methyl thiocyanate may exhibit biological activity, which could be of interest in medicinal chemistry. As with many chemical substances, safety data sheets should be consulted for information on hazards, handling, and environmental impact.
Formula:C8H5Cl2NS
InChI:InChI=1S/C8H5Cl2NS/c9-7-2-1-3-8(10)6(7)4-12-5-11/h1-3H,4H2
InChI key:InChIKey=IBWINXSTXHFYMY-UHFFFAOYSA-N
SMILES:C(SC#N)C1=C(Cl)C=CC=C1Cl
Synonyms:- NSC 118097
- 2,6-Dichlorobenzyl thiocyanate
- Thiocyanic acid, (2,6-dichlorophenyl)methyl ester
- (2,6-Dichlorophenyl)methyl thiocyanate
- Thiocyanic acid, 2,6-dichlorobenzyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
