CAS 75340-02-2
:5,7-Dihydroxy-3-(2,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one
Description:
5,7-Dihydroxy-3-(2,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one, with the CAS number 75340-02-2, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features a benzopyran core, which is typical of flavonoids, and is substituted with multiple hydroxyl and methoxy groups that contribute to its chemical properties and biological activities. The presence of hydroxyl groups enhances its potential as an antioxidant, while the methoxy groups can influence its solubility and reactivity. This compound is of interest in various fields, including medicinal chemistry and pharmacology, due to its potential therapeutic effects, such as anti-inflammatory and anticancer properties. Additionally, its structural features may allow for interactions with biological targets, making it a candidate for further research in drug development. Overall, 5,7-Dihydroxy-3-(2,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one exemplifies the diverse functionalities of flavonoids in biological systems.
Formula:C18H16O7
InChI:InChI=1S/C18H16O7/c1-22-13-7-15(24-3)14(23-2)6-10(13)11-8-25-16-5-9(19)4-12(20)17(16)18(11)21/h4-8,19-20H,1-3H3
InChI key:InChIKey=JLYUMUHNYLUAKZ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(OC)C(OC)=C1)C=2C(=O)C=3C(OC2)=CC(O)=CC3O
Synonyms:- 7-Demethylrobustigenin
- 5,7-Dihydroxy-3-(2,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(2,4,5-trimethoxyphenyl)-
- 5,7-Dihydroxy-2′,4′,5′-trimethoxyisoflavone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-Demethylrobustigenin
CAS:Controlled ProductFormula:C18H16O7Color and Shape:NeatMolecular weight:344.32
