CAS 75344-77-3
:4-BROMO-3,5-DIMETHYL-BENZONITRILE
Description:
4-Bromo-3,5-dimethyl-benzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and two methyl groups attached to a benzene ring, along with a nitrile functional group. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical syntheses, particularly in the field of pharmaceuticals and agrochemicals. The methyl groups contribute to the compound's hydrophobicity and influence its solubility in organic solvents. As a nitrile, it features a carbon triple-bonded to a nitrogen atom, which imparts specific chemical properties, including potential reactivity in nucleophilic addition reactions. This compound is typically a solid at room temperature and may exhibit moderate toxicity, necessitating appropriate safety precautions during handling. Its applications may extend to serving as an intermediate in organic synthesis or as a building block in the development of more complex molecules. Overall, 4-bromo-3,5-dimethyl-benzonitrile is a versatile compound with significant utility in synthetic organic chemistry.
Formula:C9H8BrN
InChI:InChI=1/C9H8BrN/c1-6-3-8(5-11)4-7(2)9(6)10/h3-4H,1-2H3
SMILES:Cc1cc(cc(C)c1Br)C#N
Synonyms:- 4-Bromo-3,5-dimethylbenzonitrile
- Benzonitrile, 4-bromo-3,5-dimethyl-
- 3,5-Dimethyl-4-bromobenzonitrile
- 4-Bromo-3,5-domethylbenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromo-3,5-dimethylbenzonitrile
CAS:Formula:C9H8BrNPurity:97%Color and Shape:SolidMolecular weight:210.07054-Bromo-3,5-dimethylbenzonitrile
CAS:4-Bromo-3,5-dimethylbenzonitrileFormula:C9H8BrNPurity:97%Color and Shape: white to off-white solidMolecular weight:210.07g/mol4-Bromo-3,5-dimethyl-benzonitrile
CAS:Formula:C9H8BrNPurity:97%Color and Shape:SolidMolecular weight:210.0744-Bromo-3,5-dimethylbenzonitrile
CAS:4-Bromo-3,5-dimethylbenzonitrile is a high quality reagent that has been used as an intermediate in the synthesis of complex compounds. This compound has been shown to be useful in the synthesis of fine chemicals and research chemicals. 4-Bromo-3,5-dimethylbenzonitrile is also a versatile building block for use in reactions for the production of speciality chemicals. The CAS number for this compound is 75344-77-3.Formula:C9H8BrNPurity:Min. 95%Color and Shape:PowderMolecular weight:210.07 g/mol



