CAS 753447-66-4
:3-(4-Piperidinylmethyl)-2-oxazolidinone
Description:
3-(4-Piperidinylmethyl)-2-oxazolidinone, identified by its CAS number 753447-66-4, is a chemical compound characterized by its oxazolidinone core structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the piperidine moiety, which can influence its pharmacological profile. The oxazolidinone structure is known for its role in medicinal chemistry, particularly in the development of antibiotics and other therapeutic agents. The compound may exhibit solubility in polar solvents, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, the presence of the piperidinyl group may enhance its interaction with biological targets, making it of interest in drug design and development. Overall, 3-(4-Piperidinylmethyl)-2-oxazolidinone represents a class of compounds that could have significant implications in pharmaceutical research.
Formula:C9H16N2O2
InChI:InChI=1S/C9H16N2O2/c12-9-11(5-6-13-9)7-8-1-3-10-4-2-8/h8,10H,1-7H2
InChI key:InChIKey=LYYMDLCSNYRAII-UHFFFAOYSA-N
SMILES:C(N1C(=O)OCC1)C2CCNCC2
Synonyms:- 2-Oxazolidinone, 3-(4-piperidinylmethyl)-
- 3-(4-Piperidinylmethyl)-2-oxazolidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.