
CAS 753486-91-8
:Methyl 5-hydroxy-3-methyl-4-isoxazolecarboxylate
Description:
Methyl 5-hydroxy-3-methyl-4-isoxazolecarboxylate, identified by its CAS number 753486-91-8, is a chemical compound characterized by its isoxazole ring structure, which contributes to its unique reactivity and properties. This compound features a methyl ester functional group, enhancing its solubility in organic solvents and making it suitable for various applications in organic synthesis. The presence of a hydroxyl group provides potential for hydrogen bonding, influencing its physical properties and reactivity. Methyl 5-hydroxy-3-methyl-4-isoxazolecarboxylate may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use. Overall, this compound represents a valuable entity in the field of medicinal chemistry and organic synthesis.
Formula:C6H7NO4
InChI:InChI=1S/C6H7NO4/c1-3-4(5(8)10-2)6(9)11-7-3/h9H,1-2H3
InChI key:InChIKey=LNJSMUGDXKSNCB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(C)=NOC1O
Synonyms:- 4-Isoxazolecarboxylic acid, 5-hydroxy-3-methyl-, methyl ester
- Methyl 5-hydroxy-3-methyl-4-isoxazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.