CAS 753489-92-8

2-(2-methyl-1H-benzimidazol-1-yl)propanoic acid

Description:

2-(2-methyl-1H-benzimidazol-1-yl)propanoic acid, with the CAS number 753489-92-8, is an organic compound characterized by its benzimidazole core structure, which is fused with a propanoic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the benzimidazole ring suggests it may have applications in pharmaceuticals, particularly as a bioactive agent due to its ability to interact with biological targets. The propanoic acid functional group imparts acidic characteristics, allowing for potential solubility in polar solvents and influencing its reactivity. Additionally, the methyl group on the benzimidazole ring can affect the compound's steric and electronic properties, potentially enhancing its pharmacological profile. Overall, this compound's unique structure may lead to diverse applications in medicinal chemistry and material science, warranting further investigation into its properties and potential uses.

Formula: C₁₁H₁₂N₂O₂

InChI: InChI=1/C11H12N2O2/c1-7(11(14)15)13-8(2)12-9-5-3-4-6-10(9)13/h3-7H,1-2H3,(H,14,15)

SMILES: CC(C(=O)O)n1c(C)nc2ccccc12

Synonyms:

• 1H-benzimidazole-1-acetic acid, alpha,2-dimethyl-
• 2-(2-methyl-1H-1,3-benzodiazol-1-yl)propanoic acid

2-(2-Methyl-benzoimidazol-1-yl)-propionic acid

CAS: 753489-92-8

Formula: C₁₁H₁₂N₂O₂

Purity: 95.0%

Molecular weight: 204.229

Ref: 10-F057725