CAS 75351-99-4
:8,8,8-trideuterio-3-methylene-7-(trideuteriomethyl)octa-1,6-diene
Description:
8,8,8-Trideuterio-3-methylene-7-(trideuteriomethyl)octa-1,6-diene is a deuterated organic compound characterized by its unique structure, which includes multiple deuterium atoms replacing hydrogen atoms. This substitution enhances its stability and alters its physical properties, such as boiling and melting points, compared to its non-deuterated counterparts. The presence of the diene functional group indicates that the compound contains two double bonds, which can participate in various chemical reactions, including addition and polymerization. The specific arrangement of the double bonds and substituents contributes to its reactivity and potential applications in organic synthesis and materials science. Deuterated compounds like this one are often used in NMR spectroscopy and other analytical techniques due to their distinct spectral signatures, which can aid in elucidating molecular structures. Additionally, the presence of trideuteromethyl groups suggests potential applications in isotopic labeling studies, which are valuable in tracing chemical pathways and understanding reaction mechanisms. Overall, this compound exemplifies the intersection of organic chemistry and isotopic labeling techniques.
Formula:C10H10D6
InChI:InChI=1/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7H,1,4,6,8H2,2-3H3/i2D3,3D3
SMILES:C=CC(=C)CCC=C(C([2H])([2H])[2H])C([2H])([2H])[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

