CAS 75352-01-1

Bicyclo[3.1.1]hept-2-ene, 6,6-dimethyl-2-(methyl-d3)-

Description:

Bicyclo[3.1.1]hept-2-ene, 6,6-dimethyl-2-(methyl-d3)- is a bicyclic organic compound characterized by its unique structure, which consists of a bicyclo[3.1.1] framework with a double bond located at the 2-position. The presence of two methyl groups at the 6-position and a deuterated methyl group (methyl-d3) at the 2-position contributes to its distinct chemical properties and isotopic labeling. This compound is typically colorless and may exhibit a characteristic odor. It is relatively stable under standard conditions but may undergo reactions typical of alkenes, such as electrophilic addition or polymerization. The presence of deuterium can influence its reactivity and physical properties, making it useful in studies involving isotopic effects. Bicyclic compounds like this one often exhibit unique strain and reactivity patterns due to their constrained ring systems. Its applications may extend to organic synthesis, materials science, and as a potential intermediate in the production of more complex molecules.

Formula: C₁₀H₁₃D₃

InChI: InChI=1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h4,8-9H,5-6H2,1-3H3/i1D3

InChI key: InChIKey=GRWFGVWFFZKLTI-FIBGUPNXSA-N

SMILES: CC1(C)C2CC1CC=C2C([2H])([2H])[2H]

Synonyms:

• Bicyclo[3.1.1]hept-2-ene, 6,6-dimethyl-2-(methyl-d3)-

alfa-Pinene-d3

CAS: 75352-01-1

Formula: C₁₀H₁₃D₃

Molecular weight: 139.26

Ref: 4Z-P-265007

α-Pinene-D3

Controlled Product

CAS: 75352-01-1

Formula: C₁₀H₁₃D₃

Color and Shape: Neat

Molecular weight: 139.25

Ref: TR-P466606