CAS 75353-63-8

3-Amino-2-quinolinecarboxaldehyde

Description:

3-Amino-2-quinolinecarboxaldehyde is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features an amino group (-NH2) and an aldehyde group (-CHO) attached to the quinoline ring, specifically at the 3 and 2 positions, respectively. It is typically a yellow to brown solid at room temperature and is soluble in polar organic solvents. The presence of the amino group allows for potential reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in synthetic organic chemistry. Additionally, the aldehyde functionality can participate in condensation reactions, further expanding its utility in the synthesis of more complex molecules. 3-Amino-2-quinolinecarboxaldehyde may also exhibit biological activity, which has led to interest in its potential applications in pharmaceuticals and agrochemicals. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₀H₈N₂O

InChI: InChI=1S/C10H8N2O/c11-8-5-7-3-1-2-4-9(7)12-10(8)6-13/h1-6H,11H2

InChI key: InChIKey=LLLGEVHAUSKEGA-UHFFFAOYSA-N

SMILES: C(=O)C1=NC2=C(C=C1N)C=CC=C2

Synonyms:

• 3-Amino-2-quinolinecarboxaldehyde
• 2-Quinolinecarboxaldehyde, 3-amino-
• 3-Amino-2-formylquinoline
• 3-Aminoquinoline-2-carbaldehyde