CAS 75365-06-9

L-Cysteine, N-acetyl-S-(phenylazo)-

Description:

L-Cysteine, N-acetyl-S-(phenylazo)- is a derivative of the amino acid L-cysteine, characterized by the presence of an acetyl group and a phenylazo group attached to the sulfur atom. This compound typically exhibits properties associated with both amino acids and azo compounds, including potential solubility in polar solvents due to the amino and carboxyl functional groups. The phenylazo moiety introduces chromophoric characteristics, which may impart color and allow for UV-Vis spectroscopic analysis. L-Cysteine itself is known for its role in protein synthesis and as a precursor to the antioxidant glutathione. The modification with the phenylazo group may enhance its reactivity or stability in certain chemical environments. Additionally, compounds like this can be utilized in various applications, including biochemistry, pharmaceuticals, and dye chemistry, due to their unique structural features and potential biological activities. As with any chemical substance, safety data and handling precautions should be considered, particularly due to the presence of the azo group, which can have specific regulatory implications.

Formula: C₁₁H₁₃N₃O₃S

InChI: InChI=1S/C11H13N3O3S/c1-8(15)12-10(11(16)17)7-18-14-13-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,15)(H,16,17)/t10-/m0/s1

InChI key: InChIKey=DDUFPRLGKYQAIO-JTQLQIEISA-N

SMILES: N(=NSC[C@H](NC(C)=O)C(O)=O)C1=CC=CC=C1

Synonyms:

• L-Cysteine, N-acetyl-S-(phenylazo)-
• S-Benzeneazo-N-acetyl-L-cysteine

N-Acetyl-S-(phenylazo)-L-cysteine-d5

Controlled Product

CAS: 75365-06-9

Formula: C₁₁D₅H₈N₃O₃S

Color and Shape: Neat

Molecular weight: 272.335

Ref: TR-A187026