CAS 75369-63-0

Methyl 2-[[2-methyl-3-(trifluoromethyl)phenyl]amino]-3-pyridinecarboxylate

Description:

Methyl 2-[[2-methyl-3-(trifluoromethyl)phenyl]amino]-3-pyridinecarboxylate, with the CAS number 75369-63-0, is an organic compound characterized by its complex structure, which includes a pyridine ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. The methyl ester functional group suggests that it may undergo hydrolysis to yield the corresponding carboxylic acid. Additionally, the presence of nitrogen in the pyridine ring can impart basicity and influence the compound's interaction with biological targets. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and material science.

Formula: C₁₅H₁₃F₃N₂O₂

InChI: InChI=1S/C15H13F3N2O2/c1-9-11(15(16,17)18)6-3-7-12(9)20-13-10(14(21)22-2)5-4-8-19-13/h3-8H,1-2H3,(H,19,20)

InChI key: InChIKey=YKASBHLSNBJQJF-UHFFFAOYSA-N

SMILES: N(C1=C(C(OC)=O)C=CC=N1)C2=C(C)C(C(F)(F)F)=CC=C2

Synonyms:

• Methyl 2-[[2-methyl-3-(trifluoromethyl)phenyl]amino]-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 2-[[2-methyl-3-(trifluoromethyl)phenyl]amino]-, methyl ester

Flunixin Methyl Ester

CAS: 75369-63-0

Color and Shape: Neat

Ref: 86-MM0915.05