CAS 7538-42-3
:Butenylsuccinicanhydride
Description:
Butenylsuccinic anhydride, with the CAS number 7538-42-3, is an organic compound characterized by its anhydride functional group derived from succinic acid and a butenyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in polymer chemistry and as a chemical intermediate. It exhibits properties such as low volatility and moderate solubility in organic solvents, making it useful in various applications, including as a reactive diluent in coatings and adhesives. The presence of the butenyl group enhances its ability to participate in addition reactions, which can be exploited in the synthesis of more complex molecules. Additionally, butenylsuccinic anhydride can undergo hydrolysis in the presence of water, reverting to its corresponding acid form. Safety considerations include handling it with care due to potential irritant properties, and appropriate personal protective equipment should be used to minimize exposure. Overall, butenylsuccinic anhydride is valued in industrial applications for its reactivity and versatility.
Formula:C8H10O3
InChI:InChI=1/C8H10O3/c1-2-3-4-6-5-7(9)11-8(6)10/h2-3,6H,4-5H2,1H3/b3-2+
Synonyms:- 2-Buten-1-ylsuccinic anhydride
- 3-[(2E)-but-2-en-1-yl]dihydrofuran-2,5-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Buten-1-ylsuccinic Anhydride
CAS:Formula:C8H10O3Purity:>98.0%(T)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:154.172-Buten-1-ylsuccinic anhydride
CAS:Purity:98.0%Color and Shape:LiquidMolecular weight:154.16499328613282-Buten-1-ylsuccinic Anhydride
CAS:Formula:C8H10O3Purity:98%Color and Shape:LiquidMolecular weight:154.16322-Buten-1-ylsuccinic anhydride
CAS:2-Buten-1-ylsuccinic anhydridePurity:95%Molecular weight:154.16g/mol




