CAS 75380-98-2

2-methyl-4-oxo-4-[4-(trifluoromethyl)phenyl]butanoic acid

Description:

2-Methyl-4-oxo-4-[4-(trifluoromethyl)phenyl]butanoic acid, with the CAS number 75380-98-2, is a chemical compound characterized by its unique structure that includes a butanoic acid backbone, a ketone functional group, and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, stability, and reactivity. Additionally, the compound may exhibit specific solubility characteristics in organic solvents and may participate in various chemical reactions, such as esterification or amidation, due to the presence of the carboxylic acid group. Its unique structural features may also contribute to its potential as a building block in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those with fluorinated groups, which can pose environmental and health risks.

Formula: C₁₂H₁₁F₃O₃

InChI: InChI=1/C12H11F3O3/c1-7(11(17)18)6-10(16)8-2-4-9(5-3-8)12(13,14)15/h2-5,7H,6H2,1H3,(H,17,18)

SMILES: CC(CC(=O)c1ccc(cc1)C(F)(F)F)C(=O)O

2-Methyl-4-oxo-4-[4-(trifluoromethyl)phenyl]butanoic acid

CAS: 75380-98-2

2-Methyl-4-oxo-4-[4-(trifluoromethyl)phenyl]butanoic acid

Purity: ≥95%

Molecular weight: 260.21g/mol

Ref: 54-PC8906