
CAS 7539-58-4
:Ethanol, 2-(dicyclohexylamino)-, 1,1′,1′′-triester with boric acid (H3BO3)
Description:
Ethanol, 2-(dicyclohexylamino)-, 1,1′,1′′-triester with boric acid, commonly referred to by its CAS number 7539-58-4, is a chemical compound characterized by its unique structure that combines an ethanol moiety with dicyclohexylamine and boric acid. This compound typically exhibits properties associated with both amines and esters, such as moderate solubility in organic solvents and potential reactivity with acids and bases. The presence of the boric acid component may impart certain characteristics, such as the ability to form complexes with various substrates, which can be useful in applications like catalysis or as a buffering agent. Additionally, the dicyclohexylamino group contributes to the compound's steric bulk, potentially influencing its reactivity and interaction with biological systems. Overall, this compound may find applications in fields such as organic synthesis, materials science, or medicinal chemistry, although specific applications would depend on further research into its properties and behavior in various environments.
Formula:C42H78BN3O3
InChI:InChI=1S/C42H78BN3O3/c1-7-19-37(20-8-1)44(38-21-9-2-10-22-38)31-34-47-43(48-35-32-45(39-23-11-3-12-24-39)40-25-13-4-14-26-40)49-36-33-46(41-27-15-5-16-28-41)42-29-17-6-18-30-42/h37-42H,1-36H2
InChI key:InChIKey=CLLRNFFLFVAFFV-UHFFFAOYSA-N
SMILES:N(CCOB(OCCN(C1CCCCC1)C2CCCCC2)OCCN(C3CCCCC3)C4CCCCC4)(C5CCCCC5)C6CCCCC6
Synonyms:- Ethanol, 2-(dicyclohexylamino)-, borate
- Ethanol, 2-(dicyclohexylamino)-, 1,1′,1′′-triester with boric acid (H3BO3)
- Ethanol, 2-(dicyclohexylamino)-, triester with boric acid (H3BO3)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethanol,2-(dicyclohexylamino)-, 1,1',1''-triester with boric acid (H3BO3)
CAS:Formula:C42H78BN3O3Molecular weight:683.898
