CymitQuimica logo

CAS 75391-57-0

:

4-Methoxy-3-methylphenylacetonitrile

Description:
4-Methoxy-3-methylphenylacetonitrile, with the CAS number 75391-57-0, is an organic compound characterized by its aromatic structure and the presence of both a methoxy group and a nitrile functional group. This compound features a phenyl ring substituted with a methoxy group (-OCH3) at the para position and a methyl group (-CH3) at the meta position relative to the acetonitrile group (-C≡N). It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the nitrile group contributes to its polarity and potential reactivity, making it useful in various synthetic applications, including as an intermediate in organic synthesis. Additionally, the methoxy and methyl substituents can influence its solubility and reactivity, affecting its behavior in chemical reactions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C10H11NO
InChI:InChI=1/C10H11NO/c1-8-7-9(5-6-11)3-4-10(8)12-2/h3-4,7H,5H2,1-2H3
InChI key:QOMACJMHUFTRJI-UHFFFAOYSA-N
SMILES:Cc1cc(ccc1OC)CC#N
Found 5 products.