CAS 754-43-8

(2-Bromo)hexafluoro-2-(trifluoromethyl)propane

Description:

(2-Bromo)hexafluoro-2-(trifluoromethyl)propane, with the CAS number 754-43-8, is a fluorinated organic compound characterized by its unique structure that includes both bromine and multiple fluorine atoms. This compound features a hexafluoropropane backbone, which contributes to its high stability and low reactivity due to the strong C-F bonds. The presence of the bromine atom introduces a polar functional group, which can influence its chemical behavior and interactions. Typically, such fluorinated compounds exhibit low volatility and high thermal stability, making them useful in various applications, including as solvents or intermediates in chemical synthesis. Additionally, the trifluoromethyl group enhances the compound's lipophilicity, potentially affecting its solubility in organic solvents. Due to the environmental concerns associated with halogenated compounds, particularly those containing fluorine, their use is often regulated, and they are subject to scrutiny regarding their environmental impact and potential for ozone depletion. Overall, (2-Bromo)hexafluoro-2-(trifluoromethyl)propane is notable for its unique combination of halogenated functionalities.

Formula: C₄BrF₉

InChI: InChI=1/C4BrF9/c5-1(2(6,7)8,3(9,10)11)4(12,13)14

SMILES: C(C(F)(F)F)(C(F)(F)F)(C(F)(F)F)Br

Synonyms:

• 2-Bromo-1,1,1,3,3,3-Hexafluoro-2-(Trifluoromethyl)Propane