CAS 754-79-0

2,2,3,3,4,4,5,5,6,6,6-undecafluorohexane-1,1-diol

Description:

2,2,3,3,4,4,5,5,6,6,6-undecafluorohexane-1,1-diol, with CAS number 754-79-0, is a fluorinated organic compound characterized by its unique structure featuring multiple fluorine atoms attached to a hexane backbone, along with hydroxyl (-OH) functional groups. This compound is notable for its high thermal and chemical stability, which is attributed to the strong carbon-fluorine bonds. The presence of hydroxyl groups imparts hydrophilicity, allowing for potential applications in various fields, including surfactants, coatings, and pharmaceuticals. Its fluorinated nature contributes to low surface tension and high resistance to degradation, making it useful in specialized applications where chemical inertness is required. Additionally, the compound's unique properties may influence its behavior in biological systems, necessitating careful consideration of its environmental impact and safety profile. Overall, 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexane-1,1-diol exemplifies the intriguing characteristics of fluorinated compounds in modern chemistry.

Formula: C₆H₃F₁₁O₂

InChI: InChI=1/C6H3F11O2/c7-2(8,1(18)19)3(9,10)4(11,12)5(13,14)6(15,16)17/h1,18-19H

SMILES: C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(O)O

Synonyms:

• 1,1-Hexanediol, 2,2,3,3,4,4,5,5,6,6,6-Undecafluoro-