
CAS 75405-06-0
:3-Aminopentanenitrile
Description:
3-Aminopentanenitrile, with the CAS number 75405-06-0, is an organic compound characterized by its amine and nitrile functional groups. It features a five-carbon chain with an amino group (-NH2) located at the third carbon and a nitrile group (-C≡N) at the terminal position. This structure imparts both polar and nonpolar characteristics, making it soluble in polar solvents while exhibiting hydrophobic properties due to the alkyl chain. The presence of the amino group allows for potential hydrogen bonding, which can influence its reactivity and interaction with other molecules. 3-Aminopentanenitrile is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its reactivity can be attributed to the nucleophilic nature of the amino group and the electrophilic character of the nitrile group, making it a versatile compound in various chemical reactions. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C5H10N2
InChI:InChI=1S/C5H10N2/c1-2-5(7)3-4-6/h5H,2-3,7H2,1H3
InChI key:InChIKey=FVPPLRDSFQDFLX-UHFFFAOYSA-N
SMILES:C(CC#N)(CC)N
Synonyms:- 3-Aminopentanenitrile
- Pentanenitrile, 3-amino-
- (RS)-3-Aminopentane nitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.