CAS 7541-17-5
:tert-butyl dimethylcarbamate
Description:
Tert-butyl dimethylcarbamate is an organic compound classified as a carbamate, characterized by its structure which includes a tert-butyl group and two methyl groups attached to a carbamate functional group. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. This compound is known for its use as a protecting group in organic synthesis, particularly in the protection of amines, due to its stability under various reaction conditions. Tert-butyl dimethylcarbamate is soluble in organic solvents such as dichloromethane and ethyl acetate, but has limited solubility in water. It is generally considered to have low toxicity, but like many chemical substances, it should be handled with care, following appropriate safety protocols to avoid inhalation or skin contact. Its applications extend to pharmaceuticals and agrochemicals, where it serves as an intermediate in the synthesis of more complex molecules. Proper storage conditions are essential to maintain its stability and effectiveness in chemical reactions.
Formula:C7H15NO2
InChI:InChI=1/C7H15NO2/c1-7(2,3)10-6(9)8(4)5/h1-5H3
SMILES:CC(C)(C)OC(=O)N(C)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tert-Butyl N,N-Dimethylcarbamate
CAS:Formula:C7H15NO2Purity:95%Color and Shape:LiquidMolecular weight:145.1995tert-Butyl N,N-dimethylcarbamate
CAS:tert-Butyl N,N-dimethylcarbamatePurity:98%Molecular weight:145.20g/molRef: 10-F637691
1gTo inquire2gTo inquire5gTo inquire10gTo inquire25gTo inquire50gTo inquire100mgTo inquire250mgTo inquire500mgTo inquiretert-Butyl N,N-dimethylcarbamate
CAS:<p>Tert-butyl N,N-dimethylcarbamate is a surfactant that is used as an amine. It is also an intercalator, which means it has the ability to bind to DNA. Tert-butyl N,N-dimethylcarbamate binds to DNA and disrupts replication by inhibiting the enzyme DNA polymerase. It can be used in validation of regulatory section and long-chain sequences.</p>Formula:C7H15NO2Purity:Min. 95%Molecular weight:145.2 g/mol



