CAS 75410-15-0
:3-acetyl-5-fluoropyrimidine-2,4(1H,3H)-dione
Description:
3-Acetyl-5-fluoropyrimidine-2,4(1H,3H)-dione, with the CAS number 75410-15-0, is a heterocyclic organic compound that features a pyrimidine ring substituted with an acetyl group and a fluorine atom. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is characterized by its ability to participate in various chemical reactions due to the presence of both the acetyl and fluorine substituents, which can influence its reactivity and biological activity. The fluorine atom can enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its interaction with biological targets. Additionally, the diketone functional groups contribute to its acidity and reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. The compound may also exhibit specific pharmacological properties, although detailed biological activity would require further investigation. Overall, 3-acetyl-5-fluoropyrimidine-2,4(1H,3H)-dione is of interest in both synthetic and medicinal chemistry contexts.
Formula:C6H5FN2O3
InChI:InChI=1/C6H5FN2O3/c1-3(10)9-5(11)4(7)2-8-6(9)12/h2H,1H3,(H,8,12)
SMILES:CC(=O)n1c(=O)c(cnc1O)F
Synonyms:- 2,4(1H,3H)-pyrimidinedione, 3-acetyl-5-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.