CAS 75415-03-1
:2-(1H-Pyrazol-3-yl)pyridine
Description:
2-(1H-Pyrazol-3-yl)pyridine, with the CAS number 75415-03-1, is an organic compound characterized by the presence of both a pyridine and a pyrazole ring in its structure. This compound typically exhibits a heterocyclic nature, which contributes to its potential biological activity and chemical reactivity. It is often used in medicinal chemistry and research due to its ability to interact with various biological targets. The presence of nitrogen atoms in both rings can enhance its solubility in polar solvents and influence its electronic properties. Additionally, this compound may exhibit properties such as fluorescence or photostability, making it useful in various applications, including as a ligand in coordination chemistry. Its synthesis usually involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, 2-(1H-Pyrazol-3-yl)pyridine is a versatile compound with significant implications in chemical and pharmaceutical research.
Formula:C8H7N3
InChI:InChI=1/C8H7N3/c1-2-5-9-7(3-1)8-4-6-10-11-8/h1-6H,(H,10,11)
Synonyms:- 2-(1H-Pyrazol-5-yl)pyridine
- 3-(2-Pyridyl)pyrazole
- pyridine, 2-(1H-pyrazol-3-yl)-
- pyridine, 2-(1H-pyrazol-5-yl)-
- BUTTPARK 17\04-92
- 2-(1H-PYRAZOL-3-YL)PYRIDINE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(1H-Pyrazol-3-yl)pyridine, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H7N3Purity:98%Molecular weight:145.172-(1H-Pyrazol-3-YL)Pyridine
CAS:Formula:C8H7N3Purity:97%Color and Shape:SolidMolecular weight:145.16132-(1H-Pyrazol-3-yl)pyridine
CAS:2-(1H-Pyrazol-3-yl)pyridinePurity:≥95%Color and Shape:SolidMolecular weight:145.16g/mol2-(1H-Pyrazol-3-yl)pyridine
CAS:Formula:C8H7N3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:145.172-(1H-Pyrazol-3-yl)pyridine
CAS:Formula:C8H7N3Purity:97%Color and Shape:SolidMolecular weight:145.165




