CAS 754153-28-1
:5-Amino-2,3-dihydro-1H-indene-1-carboxylic acid methyl ester
Description:
5-Amino-2,3-dihydro-1H-indene-1-carboxylic acid methyl ester is an organic compound characterized by its indene structure, which features a fused bicyclic system. The presence of an amino group (-NH2) and a carboxylic acid methyl ester (-COOCH3) contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits moderate solubility in polar solvents due to the presence of the amino and ester functional groups, while its indene core may impart hydrophobic characteristics. The compound's molecular structure suggests potential for hydrogen bonding, influencing its interactions in biological systems. It may serve as a building block in the synthesis of more complex molecules or as a precursor in pharmaceutical development. Additionally, the compound's unique structure may confer specific biological activities, making it of interest in drug discovery and development. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C11H13NO2
InChI:InChI=1/C11H13NO2/c1-14-11(13)10-4-2-7-6-8(12)3-5-9(7)10/h3,5-6,10H,2,4,12H2,1H3
SMILES:COC(=O)C1CCc2cc(ccc12)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
