CymitQuimica logo

CAS 754162-13-5

:

N-(3-aminophenyl)-3-phenylpropanamide

Description:
N-(3-aminophenyl)-3-phenylpropanamide, identified by its CAS number 754162-13-5, is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a phenyl group and an amino group attached to a propanamide backbone, contributing to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds like this can exhibit properties such as moderate to high melting points and varying solubility in polar and non-polar solvents, depending on the specific substituents and their arrangement. Additionally, due to its structural features, N-(3-aminophenyl)-3-phenylpropanamide may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it could interact with biological targets. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise determination.
Formula:C15H16N2O
InChI:InChI=1/C15H16N2O/c16-13-7-4-8-14(11-13)17-15(18)10-9-12-5-2-1-3-6-12/h1-8,11H,9-10,16H2,(H,17,18)
SMILES:c1ccc(cc1)CCC(=Nc1cccc(c1)N)O
Synonyms:
  • benzenepropanamide, N-(3-aminophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.