CymitQuimica logo

CAS 754165-50-9

:

4-Amino-3-cyclopropylbenzoic acid

Description:
4-Amino-3-cyclopropylbenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an amino group and a cyclopropyl group. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, making it potentially soluble in polar solvents. The cyclopropyl group, a three-membered carbon ring, introduces unique steric and electronic properties that can influence the compound's reactivity and interactions with biological targets. This compound may exhibit acidic properties due to the carboxylic acid functional group (-COOH), allowing it to donate protons in solution. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the modifications can enhance biological activity or selectivity. Additionally, the compound's stability and reactivity can be influenced by the presence of the cyclopropyl group, which may affect its pharmacokinetic properties. Overall, 4-Amino-3-cyclopropylbenzoic acid is a compound of interest for further research in various chemical and biological contexts.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c11-9-4-3-7(10(12)13)5-8(9)6-1-2-6/h3-6H,1-2,11H2,(H,12,13)
InChI key:InChIKey=IQENRSYKXKPHPP-UHFFFAOYSA-N
SMILES:NC=1C(=CC(C(O)=O)=CC1)C2CC2
Synonyms:
  • 4-Amino-3-cyclopropylbenzoic acid
  • Benzoic acid, 4-amino-3-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.