
CAS 754180-82-0
:Poly(oxy-1,2-ethanediyl), α-[(9R)-6-hydroxy-6-oxido-1,12-dioxo-9-[(1-oxooctadecyl)oxy]-5,7,11-trioxa-2-aza-6-phosphanonacos-1-yl]-ω-(carboxymethoxy)-
Description:
Poly(oxy-1,2-ethanediyl), α-[(9R)-6-hydroxy-6-oxido-1,12-dioxo-9-[(1-oxooctadecyl)oxy]-5,7,11-trioxa-2-aza-6-phosphanonacos-1-yl]-ω-(carboxymethoxy)-, identified by CAS number 754180-82-0, is a complex polymeric compound characterized by its amphiphilic nature, which arises from the presence of both hydrophilic poly(ethylene glycol) segments and hydrophobic alkyl chains. This structure allows it to function effectively as a surfactant or emulsifier in various applications, including pharmaceuticals and cosmetics. The presence of phosphonate and carboxymethoxy groups contributes to its potential as a biocompatible agent, enhancing solubility and stability in aqueous environments. Additionally, the hydroxyl and oxido groups may impart antioxidant properties, making it suitable for formulations aimed at protecting against oxidative stress. Its unique structural features enable it to interact with biological membranes, potentially facilitating drug delivery or enhancing the bioavailability of therapeutic agents. Overall, this compound exhibits versatile properties that can be tailored for specific applications in drug formulation and delivery systems.
Formula:(C2H4O)nC44H84NO12P
Synonyms:- Poly(oxy-1,2-ethanediyl), α-[(9R)-6-hydroxy-6-oxido-1,12-dioxo-9-[(1-oxooctadecyl)oxy]-5,7,11-trioxa-2-aza-6-phosphanonacos-1-yl]-ω-(carboxymethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Poly(oxy-1,2-ethanediyl), α-[(9R)-6-hydroxy-6-oxido-1,12-dioxo-9-[(1-oxooctadecyl)oxy]-5,7,11-trioxa-2-aza-6-phosphanonacos-1-yl]-ω-(carboxymethoxy)-
CAS:Formula:C46H88NO13PMolecular weight:894.1636
