CAS 754183-67-0
:[1-(1-methylethyl)piperidin-4-yl]acetic acid
Description:
[1-(1-methylethyl)piperidin-4-yl]acetic acid, with the CAS number 754183-67-0, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an isopropyl group attached to the nitrogen atom of the piperidine, contributing to its steric properties. The presence of the acetic acid functional group indicates that it has acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, while the hydrophobic isopropyl group may influence its overall lipophilicity. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with biological activity. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C10H19NO2
InChI:InChI=1/C10H19NO2/c1-8(2)11-5-3-9(4-6-11)7-10(12)13/h8-9H,3-7H2,1-2H3,(H,12,13)
SMILES:CC(C)N1CCC(CC1)CC(=O)O
Synonyms:- [1-(Propan-2-Yl)Piperidin-4-Yl]Acetic Acid
- 4-Piperidineacetic Acid, 1-(1-Methylethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(1-Isopropylpiperidin-4-yl)acetic acid
CAS:(1-Isopropylpiperidin-4-yl)acetic acid is a fine chemical that has a versatile scaffold and can be used as a building block in the synthesis of complex compounds. It is also useful as a reaction component or reagent in the synthesis of new speciality chemicals. This chemical is available in high quality and purity grades.Formula:C10H19NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:185.26 g/mol

