CymitQuimica logo

CAS 754183-77-2

:

4-[[2-(Trifluoromethyl)phenoxy]methyl]piperidine

Description:
4-[[2-(Trifluoromethyl)phenoxy]methyl]piperidine, identified by its CAS number 754183-77-2, is a chemical compound characterized by its unique structure, which includes a piperidine ring and a trifluoromethyl-substituted phenoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in medicinal chemistry and material science. The presence of the trifluoromethyl group enhances lipophilicity and metabolic stability, making it a candidate for various pharmaceutical applications. Additionally, the piperidine moiety is known for its role in influencing biological activity, often acting as a basic nitrogen-containing heterocycle. The compound's solubility, reactivity, and interaction with biological targets can be influenced by the specific arrangement of its functional groups. Overall, 4-[[2-(Trifluoromethyl)phenoxy]methyl]piperidine represents a versatile structure that may be explored for its potential therapeutic effects and utility in chemical synthesis.
Formula:C13H16F3NO
InChI:InChI=1S/C13H16F3NO/c14-13(15,16)11-3-1-2-4-12(11)18-9-10-5-7-17-8-6-10/h1-4,10,17H,5-9H2
InChI key:InChIKey=QVAHSKGQTQYTLR-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(OCC2CCNCC2)C=CC=C1
Synonyms:
  • 4-[[2-(Trifluoromethyl)phenoxy]methyl]piperidine
  • Piperidine, 4-[[2-(trifluoromethyl)phenoxy]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.