CAS 75419-36-2
:(1R,2S,3S,4R,5S)-5-aminocyclohexane-1,2,3,4-tetrol
Description:
The chemical substance known as (1R,2S,3S,4R,5S)-5-aminocyclohexane-1,2,3,4-tetrol, with the CAS number 75419-36-2, is a polyol compound characterized by the presence of multiple hydroxyl (-OH) groups and an amino (-NH2) group. This compound features a cyclohexane ring structure, which contributes to its cyclic nature and stereochemistry, as indicated by its specific stereochemical descriptors. The presence of four hydroxyl groups makes it a tetrol, which enhances its solubility in water and potential for hydrogen bonding. The amino group introduces basic properties and potential reactivity, allowing for interactions with acids and other electrophiles. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug development or as a building block for more complex molecules. Its stereochemistry suggests that it may exhibit specific biological activities or interactions, making it a candidate for further research in medicinal chemistry.
Formula:C6H13NO4
InChI:InChI=1/C6H13NO4/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,8-11H,1,7H2/t2-,3+,4+,5-,6-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Amino-1,2-dideoxy-scyllo-inositol
CAS:1-Amino-1,2-dideoxy-scyllo-inositolFormula:C6H13NO4Molecular weight:163.171723-Amino-2,3-dideoxy-D-myo-inositol
CAS:Controlled ProductFormula:C6H13NO4Color and Shape:NeatMolecular weight:163.1723-Amino-2,3-dideoxy-D-myo-inositol
CAS:3-Amino-2,3-dideoxy-D-myo-inositol (3ADMI) is a gene product that belongs to the class of chemical biology. It is an actuator that has been shown to be able to bind and activate enzymes. 3ADMI is used as a substrate in the calibration of enzyme kinetics and as an analog for aminoglycosides. The conjugates of 3ADMI have been shown to prevent viral replication by inhibiting the synthesis of DNA or RNA.
Formula:C6H13NO4Purity:Min. 95%Color and Shape:White/Off-White SolidMolecular weight:163.17 g/mol



