CAS 754193-08-3

N-(4-amino-2-chlorophenyl)propanamide

Description:

N-(4-amino-2-chlorophenyl)propanamide, identified by its CAS number 754193-08-3, is an organic compound characterized by its amide functional group and a substituted aromatic ring. This compound features a propanamide backbone, where the amide nitrogen is bonded to a 4-amino-2-chlorophenyl group, indicating the presence of both an amino group and a chlorine atom on the aromatic ring. The chlorine substitution typically influences the compound's reactivity and solubility, while the amino group can participate in hydrogen bonding, enhancing its potential interactions in biological systems. This compound may exhibit properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in pharmaceutical research. Its structural characteristics suggest it could be involved in various chemical reactions, including acylation and nucleophilic substitutions. Overall, N-(4-amino-2-chlorophenyl)propanamide represents a class of compounds that may have applications in medicinal chemistry and materials science.

Formula: C₉H₁₁ClN₂O

InChI: InChI=1/C9H11ClN2O/c1-2-9(13)12-8-4-3-6(11)5-7(8)10/h3-5H,2,11H2,1H3,(H,12,13)

SMILES: CCC(=Nc1ccc(cc1Cl)N)O